* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH592856 |
English Synonyms: | FCHGROUP FCH592856 |
MDL Number.: | MFCD17352927 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCNCC1CCN(C1)[C@@]23C[C@H]4C[C@@H](C2)C[C@H](C4)C3 |
InChi: | InChI=1S/C17H30N2/c1-2-18-11-13-3-4-19(12-13)17-8-14-5-15(9-17)7-16(6-14)10-17/h13-16,18H,2-12H2,1H3/t13?,14-,15+,16-,17- |
InChiKey: | InChIKey=CNVILRANSLOECY-VFEQZJCSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.