* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH593208 |
English Synonyms: | FCHGROUP FCH593208 |
MDL Number.: | MFCD17353275 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCNCC1CCN(C1)Cc2nncn2C |
InChi: | InChI=1S/C12H23N5/c1-3-5-13-7-11-4-6-17(8-11)9-12-15-14-10-16(12)2/h10-11,13H,3-9H2,1-2H3 |
InChiKey: | InChIKey=SDRJPMSBUBMCMR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.