* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH593304 |
English Synonyms: | FCHGROUP FCH593304 |
MDL Number.: | MFCD17353370 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCOCCOCC(CNCc1ccc(o1)C)O |
InChi: | InChI=1S/C13H23NO4/c1-3-16-6-7-17-10-12(15)8-14-9-13-5-4-11(2)18-13/h4-5,12,14-15H,3,6-10H2,1-2H3 |
InChiKey: | InChIKey=UTYKJAWEGWWBNC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.