* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH593306 |
English Synonyms: | FCHGROUP FCH593306 |
MDL Number.: | MFCD17353372 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CCN(CC)CC(CNCc1ccc(o1)C)O |
InChi: | InChI=1S/C13H24N2O2/c1-4-15(5-2)10-12(16)8-14-9-13-7-6-11(3)17-13/h6-7,12,14,16H,4-5,8-10H2,1-3H3 |
InChiKey: | InChIKey=UHEFWPJEJUJFFM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.