* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH594044 |
English Synonyms: | FCHGROUP FCH594044 |
MDL Number.: | MFCD17354109 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCC(CC)(CO)NS(=O)(=O)c1cccnc1Cl |
InChi: | InChI=1S/C11H17ClN2O3S/c1-3-11(4-2,8-15)14-18(16,17)9-6-5-7-13-10(9)12/h5-7,14-15H,3-4,8H2,1-2H3 |
InChiKey: | InChIKey=QURBSULXGWZNKE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.