* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH618513 |
| English Synonyms: | FCHGROUP FCH618513 |
| MDL Number.: | MFCD17376494 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | c1cn(cn1)CCCNC(=O)c2c(non2)N |
| InChi: | InChI=1S/C9H12N6O2/c10-8-7(13-17-14-8)9(16)12-2-1-4-15-5-3-11-6-15/h3,5-6H,1-2,4H2,(H2,10,14)(H,12,16) |
| InChiKey: | InChIKey=ZDIDUDFBKVQPQB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.