* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH619953 |
English Synonyms: | FCHGROUP FCH619953 |
MDL Number.: | MFCD17377912 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)cc(s2)C(=O)NC(C3CC3)C(=O)O |
InChi: | InChI=1S/C14H13NO3S/c16-13(15-12(14(17)18)8-5-6-8)11-7-9-3-1-2-4-10(9)19-11/h1-4,7-8,12H,5-6H2,(H,15,16)(H,17,18) |
InChiKey: | InChIKey=CSNLVXLZTZWMOL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.