* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH620203 |
English Synonyms: | FCHGROUP FCH620203 |
MDL Number.: | MFCD17378162 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | C1CC2C(C1)OCCN2C(=O)NC(C3CC3)C(=O)O |
InChi: | InChI=1S/C13H20N2O4/c16-12(17)11(8-4-5-8)14-13(18)15-6-7-19-10-3-1-2-9(10)15/h8-11H,1-7H2,(H,14,18)(H,16,17) |
InChiKey: | InChIKey=TYGPCLAGEFRZEJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.