* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH620460 |
| English Synonyms: | FCHGROUP FCH620460 |
| MDL Number.: | MFCD17378419 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(c(n1)NCC2CCS(=O)(=O)C2)C(=O)O |
| InChi: | InChI=1S/C12H16N2O4S/c1-8-2-3-10(12(15)16)11(14-8)13-6-9-4-5-19(17,18)7-9/h2-3,9H,4-7H2,1H3,(H,13,14)(H,15,16) |
| InChiKey: | InChIKey=CGKLMPCZVVLJFS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.