* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH622507 |
English Synonyms: | FCHGROUP FCH622507 |
MDL Number.: | MFCD17380438 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCC(C)(CNCC)C1CS(=O)(=O)c2c1cccc2 |
InChi: | InChI=1S/C15H23NO2S/c1-4-15(3,11-16-5-2)13-10-19(17,18)14-9-7-6-8-12(13)14/h6-9,13,16H,4-5,10-11H2,1-3H3 |
InChiKey: | InChIKey=JNFDHBVOQNNKEJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.