* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH622766 |
English Synonyms: | FCHGROUP FCH622766 |
MDL Number.: | MFCD17380690 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | c1ccc(c(c1)n2cc(cn2)CCCCl)[N+](=O)[O-] |
InChi: | InChI=1S/C12H12ClN3O2/c13-7-3-4-10-8-14-15(9-10)11-5-1-2-6-12(11)16(17)18/h1-2,5-6,8-9H,3-4,7H2 |
InChiKey: | InChIKey=BHSPCPVFPIXOEB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.