* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH623056 |
English Synonyms: | FCHGROUP FCH623056 |
MDL Number.: | MFCD17380970 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC1CCCC(C1)SCCNCCc2cccs2 |
InChi: | InChI=1S/C15H25NS2/c1-13-4-2-5-15(12-13)18-11-9-16-8-7-14-6-3-10-17-14/h3,6,10,13,15-16H,2,4-5,7-9,11-12H2,1H3 |
InChiKey: | InChIKey=SOQZXZYSRHDYPN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.