* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | FCHGROUP FCH629540 |
English Synonyms: | FCHGROUP FCH629540 |
MDL Number.: | MFCD17386710 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CCCc1c(sc(n1)N(C)Cc2cnn(c2)C)C=O |
InChi: | InChI=1S/C13H18N4OS/c1-4-5-11-12(9-18)19-13(15-11)16(2)7-10-6-14-17(3)8-10/h6,8-9H,4-5,7H2,1-3H3 |
InChiKey: | InChIKey=SEYHZSMLFMKJAV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.