* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-[3-(PROPAN-2-YL)-1H-1,2,4-TRIAZOL-5-YL]QUINOLINE |
English Synonyms: | 8-[3-(PROPAN-2-YL)-1H-1,2,4-TRIAZOL-5-YL]QUINOLINE |
MDL Number.: | MFCD17397938 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)c1nc([nH]n1)c2cccc3c2nccc3 |
InChi: | InChI=1S/C14H14N4/c1-9(2)13-16-14(18-17-13)11-7-3-5-10-6-4-8-15-12(10)11/h3-9H,1-2H3,(H,16,17,18) |
InChiKey: | InChIKey=SWYMPNVXDQUTIU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.