* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-(1,2-OXAZOL-4-YL)-1H-INDAZOLE-6-CARBOXAMIDE |
English Synonyms: | N-(1,2-OXAZOL-4-YL)-1H-INDAZOLE-6-CARBOXAMIDE |
MDL Number.: | MFCD17405412 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cc2cn[nH]c2cc1C(=O)Nc3cnoc3 |
InChi: | InChI=1S/C11H8N4O2/c16-11(14-9-5-13-17-6-9)7-1-2-8-4-12-15-10(8)3-7/h1-6H,(H,12,15)(H,14,16) |
InChiKey: | InChIKey=YVMABTLTJMBFBL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.