* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(4-HYDROXYBUT-1-YN-1-YL)-N-(1,2-OXAZOL-4-YL)BENZAMIDE |
English Synonyms: | 4-(4-HYDROXYBUT-1-YN-1-YL)-N-(1,2-OXAZOL-4-YL)BENZAMIDE |
MDL Number.: | MFCD17405414 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc(ccc1C#CCCO)C(=O)Nc2cnoc2 |
InChi: | InChI=1S/C14H12N2O3/c17-8-2-1-3-11-4-6-12(7-5-11)14(18)16-13-9-15-19-10-13/h4-7,9-10,17H,2,8H2,(H,16,18) |
InChiKey: | InChIKey=CMPKZQRBLSPPHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.