* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH650975 |
English Synonyms: | FCHGROUP FCH650975 |
MDL Number.: | MFCD17405417 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc(c(cc1F)C(=O)Nc2cnoc2)C#CCN |
InChi: | InChI=1S/C13H10FN3O2/c14-10-4-3-9(2-1-5-15)12(6-10)13(18)17-11-7-16-19-8-11/h3-4,6-8H,5,15H2,(H,17,18) |
InChiKey: | InChIKey=XKIATTGMTJVYRO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.