* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH652332 |
English Synonyms: | FCHGROUP FCH652332 |
MDL Number.: | MFCD17406753 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1ccc(c(c1)/C=C/C(=O)N2CCC(C2)O)OC |
InChi: | InChI=1S/C15H19NO3/c1-11-3-5-14(19-2)12(9-11)4-6-15(18)16-8-7-13(17)10-16/h3-6,9,13,17H,7-8,10H2,1-2H3/b6-4+ |
InChiKey: | InChIKey=OHTRMHGFVIZTET-GQCTYLIASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.