* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(1,4-DIAZEPAN-1-YL)-2-(3-HYDROXYPYRROLIDIN-1-YL)ETHANE-1,2-DIONE |
English Synonyms: | 1-(1,4-DIAZEPAN-1-YL)-2-(3-HYDROXYPYRROLIDIN-1-YL)ETHANE-1,2-DIONE |
MDL Number.: | MFCD17407211 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | C1CNCCN(C1)C(=O)C(=O)N2CCC(C2)O |
InChi: | InChI=1S/C11H19N3O3/c15-9-2-6-14(8-9)11(17)10(16)13-5-1-3-12-4-7-13/h9,12,15H,1-8H2 |
InChiKey: | InChIKey=VUVHWWGIJMDOQJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.