* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH653401 |
English Synonyms: | FCHGROUP FCH653401 |
MDL Number.: | MFCD17407809 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc(c(c1)O)Oc2c(=O)n(ccn2)C3CC3 |
InChi: | InChI=1S/C13H12N2O3/c16-10-3-1-2-4-11(10)18-12-13(17)15(8-7-14-12)9-5-6-9/h1-4,7-9,16H,5-6H2 |
InChiKey: | InChIKey=VQPHHZWMGWKTBO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.