* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH654236 |
English Synonyms: | FCHGROUP FCH654236 |
MDL Number.: | MFCD17408627 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | c1cnc(cc1N2CCS(=O)(=O)CC2)/C(=N\O)/N |
InChi: | InChI=1S/C10H14N4O3S/c11-10(13-15)9-7-8(1-2-12-9)14-3-5-18(16,17)6-4-14/h1-2,7,15H,3-6H2,(H2,11,13) |
InChiKey: | InChIKey=HVFIVUZSWIZOHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.