* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH658772 |
English Synonyms: | FCHGROUP FCH658772 |
MDL Number.: | MFCD17411893 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC(C)C[C@H](C(=O)O)NC(=O)c1ccc(cn1)Br |
InChi: | InChI=1S/C12H15BrN2O3/c1-7(2)5-10(12(17)18)15-11(16)9-4-3-8(13)6-14-9/h3-4,6-7,10H,5H2,1-2H3,(H,15,16)(H,17,18)/t10-/m1/s1 |
InChiKey: | InChIKey=WBORMVOKFHVTAG-SNVBAGLBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.