* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH659404 |
| English Synonyms: | FCHGROUP FCH659404 |
| MDL Number.: | MFCD17412514 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCCn1ccnc1CNC(C)Cn2cccn2 |
| InChi: | InChI=1S/C13H21N5/c1-3-7-17-9-6-14-13(17)10-15-12(2)11-18-8-4-5-16-18/h4-6,8-9,12,15H,3,7,10-11H2,1-2H3 |
| InChiKey: | InChIKey=LJBYNZHBXABFFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.