* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH659417 |
| English Synonyms: | FCHGROUP FCH659417 |
| MDL Number.: | MFCD17412527 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCn1ccnc1CNCCC2CCCO2 |
| InChi: | InChI=1S/C13H23N3O/c1-2-8-16-9-7-15-13(16)11-14-6-5-12-4-3-10-17-12/h7,9,12,14H,2-6,8,10-11H2,1H3 |
| InChiKey: | InChIKey=HLLFVWOPKZOVIF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.