* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH659419 |
| English Synonyms: | FCHGROUP FCH659419 |
| MDL Number.: | MFCD17412529 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCCn1ccnc1CNCCc2nccn2C |
| InChi: | InChI=1S/C13H21N5/c1-3-8-18-10-7-16-13(18)11-14-5-4-12-15-6-9-17(12)2/h6-7,9-10,14H,3-5,8,11H2,1-2H3 |
| InChiKey: | InChIKey=LQHIXCHNEPRJPW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.