* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH663159 |
| English Synonyms: | FCHGROUP FCH663159 |
| MDL Number.: | MFCD17416224 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cn1)CNC2CCS(=O)(=O)CC2 |
| InChi: | InChI=1S/C12H18N2O2S/c1-10-2-3-11(8-13-10)9-14-12-4-6-17(15,16)7-5-12/h2-3,8,12,14H,4-7,9H2,1H3 |
| InChiKey: | InChIKey=MJWNSYSZPOSQEG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.