* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH667348 |
English Synonyms: | FCHGROUP FCH667348 |
MDL Number.: | MFCD17419172 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc(c(c1)CC(c2cc3c(s2)CCC3)O)F |
InChi: | InChI=1S/C15H15FOS/c16-12-6-2-1-4-10(12)8-13(17)15-9-11-5-3-7-14(11)18-15/h1-2,4,6,9,13,17H,3,5,7-8H2 |
InChiKey: | InChIKey=VBAQUYPUGKWCOD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.