* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH668029 |
| English Synonyms: | FCHGROUP FCH668029 |
| MDL Number.: | MFCD17419838 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | COCCNCC1(CCCOC1)Cc2ccsc2 |
| InChi: | InChI=1S/C14H23NO2S/c1-16-7-5-15-11-14(4-2-6-17-12-14)9-13-3-8-18-10-13/h3,8,10,15H,2,4-7,9,11-12H2,1H3 |
| InChiKey: | InChIKey=ZHYIBWAXEPVKEI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.