* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH668573 |
| English Synonyms: | FCHGROUP FCH668573 |
| MDL Number.: | MFCD17420378 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCNC(C)(CN1CCn2ccnc2C1)C(=O)N |
| InChi: | InChI=1S/C12H21N5O/c1-3-15-12(2,11(13)18)9-16-6-7-17-5-4-14-10(17)8-16/h4-5,15H,3,6-9H2,1-2H3,(H2,13,18) |
| InChiKey: | InChIKey=GASOQJDQBRFVLS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.