* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH668608 |
English Synonyms: | FCHGROUP FCH668608 |
MDL Number.: | MFCD17420413 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cn1ccnc1CN(C)C(=N)NC2CCCC2 |
InChi: | InChI=1S/C12H21N5/c1-16-8-7-14-11(16)9-17(2)12(13)15-10-5-3-4-6-10/h7-8,10H,3-6,9H2,1-2H3,(H2,13,15) |
InChiKey: | InChIKey=KXMIUVYABNSTQR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.