* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH668726 |
| English Synonyms: | FCHGROUP FCH668726 |
| MDL Number.: | MFCD17420531 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1cn2c(n1)CN(CC2)CCNCC3CCOC3 |
| InChi: | InChI=1S/C13H22N4O/c1-8-18-11-12(1)9-14-2-4-16-6-7-17-5-3-15-13(17)10-16/h3,5,12,14H,1-2,4,6-11H2 |
| InChiKey: | InChIKey=BLJFJJJLLICSCU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.