* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH669171 |
English Synonyms: | FCHGROUP FCH669171 |
MDL Number.: | MFCD17420973 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(c1nncn1C)NC2CC3CCC2(C3(C)C)C |
InChi: | InChI=1S/C15H26N4/c1-10(13-18-16-9-19(13)5)17-12-8-11-6-7-15(12,4)14(11,2)3/h9-12,17H,6-8H2,1-5H3 |
InChiKey: | InChIKey=NYETTZBBMMMRBA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.