* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH669173 |
English Synonyms: | FCHGROUP FCH669173 |
MDL Number.: | MFCD17420975 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(Cn1ccnc1)NC2CC3CCC2(C3(C)C)C |
InChi: | InChI=1S/C16H27N3/c1-12(10-19-8-7-17-11-19)18-14-9-13-5-6-16(14,4)15(13,2)3/h7-8,11-14,18H,5-6,9-10H2,1-4H3 |
InChiKey: | InChIKey=BJUFEYGASSRRPA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.