* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH671906 |
English Synonyms: | FCHGROUP FCH671906 |
MDL Number.: | MFCD17423657 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc(ccc1C(=O)NC2CCCC(C2)C(=O)O)Br |
InChi: | InChI=1S/C14H16BrNO3/c15-11-6-4-9(5-7-11)13(17)16-12-3-1-2-10(8-12)14(18)19/h4-7,10,12H,1-3,8H2,(H,16,17)(H,18,19) |
InChiKey: | InChIKey=KINKCJCOMUAXKB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.