* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH671912 |
English Synonyms: | FCHGROUP FCH671912 |
MDL Number.: | MFCD17423662 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cocc1C(=O)NC2CCCC(C2)C(=O)O |
InChi: | InChI=1S/C12H15NO4/c14-11(9-4-5-17-7-9)13-10-3-1-2-8(6-10)12(15)16/h4-5,7-8,10H,1-3,6H2,(H,13,14)(H,15,16) |
InChiKey: | InChIKey=HBCLOAILAQSSNO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.