* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH671920 |
English Synonyms: | FCHGROUP FCH671920 |
MDL Number.: | MFCD17423669 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cn1cccc1C(=O)NC2CCCC(C2)C(=O)O |
InChi: | InChI=1S/C13H18N2O3/c1-15-7-3-6-11(15)12(16)14-10-5-2-4-9(8-10)13(17)18/h3,6-7,9-10H,2,4-5,8H2,1H3,(H,14,16)(H,17,18) |
InChiKey: | InChIKey=KMZDGRCCDFMILV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.