* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH671921 |
English Synonyms: | FCHGROUP FCH671921 |
MDL Number.: | MFCD17423670 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cn1cc(cc1C(=O)NC2CCCC(C2)C(=O)O)Cl |
InChi: | InChI=1S/C13H17ClN2O3/c1-16-7-9(14)6-11(16)12(17)15-10-4-2-3-8(5-10)13(18)19/h6-8,10H,2-5H2,1H3,(H,15,17)(H,18,19) |
InChiKey: | InChIKey=IDMKEYPFGFAMFI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.