* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH672415 |
English Synonyms: | FCHGROUP FCH672415 |
MDL Number.: | MFCD17424152 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCNCc1ccc(c(c1)Br)OC2CCS(=O)(=O)C2 |
InChi: | InChI=1S/C13H18BrNO3S/c1-2-15-8-10-3-4-13(12(14)7-10)18-11-5-6-19(16,17)9-11/h3-4,7,11,15H,2,5-6,8-9H2,1H3 |
InChiKey: | InChIKey=ZBFKDFQHVQOICY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.