* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH673519 |
English Synonyms: | FCHGROUP FCH673519 |
MDL Number.: | MFCD17425244 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C/C=C/COc1ccc(cc1)CNCC(C)C |
InChi: | InChI=1S/C15H23NO/c1-4-5-10-17-15-8-6-14(7-9-15)12-16-11-13(2)3/h4-9,13,16H,10-12H2,1-3H3/b5-4+ |
InChiKey: | InChIKey=QSHPCOFORJALQZ-SNAWJCMRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.