* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH673786 |
| English Synonyms: | FCHGROUP FCH673786 |
| MDL Number.: | MFCD17425499 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | C/C=C/COc1cc(ccc1CNCCOC)OC |
| InChi: | InChI=1S/C15H23NO3/c1-4-5-9-19-15-11-14(18-3)7-6-13(15)12-16-8-10-17-2/h4-7,11,16H,8-10,12H2,1-3H3/b5-4+ |
| InChiKey: | InChIKey=CMJQTAXSJKGIQA-SNAWJCMRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.