* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH674071 |
| English Synonyms: | FCHGROUP FCH674071 |
| MDL Number.: | MFCD17425784 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCc1nccn1c2ccccc2CNCCOC |
| InChi: | InChI=1S/C15H21N3O/c1-3-15-17-8-10-18(15)14-7-5-4-6-13(14)12-16-9-11-19-2/h4-8,10,16H,3,9,11-12H2,1-2H3 |
| InChiKey: | InChIKey=PJYNDAWBVNPOHS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.