* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH674325 |
| English Synonyms: | FCHGROUP FCH674325 |
| MDL Number.: | MFCD17426037 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | CC(C)CN(CC(=O)O)C(=O)c1nc([nH]n1)N |
| InChi: | InChI=1S/C9H15N5O3/c1-5(2)3-14(4-6(15)16)8(17)7-11-9(10)13-12-7/h5H,3-4H2,1-2H3,(H,15,16)(H3,10,11,12,13) |
| InChiKey: | InChIKey=IRGXFMXMQZATBM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.