* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH674338 |
English Synonyms: | FCHGROUP FCH674338 |
MDL Number.: | MFCD17426050 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | CC(C)CN(CC(=O)O)C(=O)C1CC(CN1)O |
InChi: | InChI=1S/C11H20N2O4/c1-7(2)5-13(6-10(15)16)11(17)9-3-8(14)4-12-9/h7-9,12,14H,3-6H2,1-2H3,(H,15,16) |
InChiKey: | InChIKey=RPWAKHJUNHBHHX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.