* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH674587 |
English Synonyms: | FCHGROUP FCH674587 |
MDL Number.: | MFCD17426295 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | Cc1ncc(s1)COc2cc(ccc2C(=O)C)F |
InChi: | InChI=1S/C13H12FNO2S/c1-8(16)12-4-3-10(14)5-13(12)17-7-11-6-15-9(2)18-11/h3-6H,7H2,1-2H3 |
InChiKey: | InChIKey=XDGYXHPPDFCUAG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.