* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH675144 |
| English Synonyms: | FCHGROUP FCH675144 |
| MDL Number.: | MFCD17426849 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1c(c(n(n1)Cc2ccc(cc2F)C(=O)O)C)Cl |
| InChi: | InChI=1S/C13H12ClFN2O2/c1-7-12(14)8(2)17(16-7)6-10-4-3-9(13(18)19)5-11(10)15/h3-5H,6H2,1-2H3,(H,18,19) |
| InChiKey: | InChIKey=AYAIAFNHMLZMDX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.