* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH675780 |
| English Synonyms: | FCHGROUP FCH675780 |
| MDL Number.: | MFCD17427484 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | c1cn(c(n1)C=O)CC(=O)NC2CCOCC2 |
| InChi: | InChI=1S/C11H15N3O3/c15-8-10-12-3-4-14(10)7-11(16)13-9-1-5-17-6-2-9/h3-4,8-9H,1-2,5-7H2,(H,13,16) |
| InChiKey: | InChIKey=JKTKBORRSOILQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.