* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH676085 |
English Synonyms: | FCHGROUP FCH676085 |
MDL Number.: | MFCD17427780 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(c1cnc(s1)C(C)(C)c2ccccc2)O |
InChi: | InChI=1S/C14H17NOS/c1-10(16)12-9-15-13(17-12)14(2,3)11-7-5-4-6-8-11/h4-10,16H,1-3H3 |
InChiKey: | InChIKey=YGXYMBRNKDUAQJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.