* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH676458 |
| English Synonyms: | FCHGROUP FCH676458 |
| MDL Number.: | MFCD17428150 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | c1cc(cc(c1)C#CCO)CNC(=O)c2cc[nH]n2 |
| InChi: | InChI=1S/C14H13N3O2/c18-8-2-5-11-3-1-4-12(9-11)10-15-14(19)13-6-7-16-17-13/h1,3-4,6-7,9,18H,8,10H2,(H,15,19)(H,16,17) |
| InChiKey: | InChIKey=IXLOJUIPTBNCIC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.