* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH676461 |
English Synonyms: | FCHGROUP FCH676461 |
MDL Number.: | MFCD17428153 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1cc(ccc1C#CCN)NC(=O)c2cc[nH]n2 |
InChi: | InChI=1S/C13H12N4O/c14-8-1-2-10-3-5-11(6-4-10)16-13(18)12-7-9-15-17-12/h3-7,9H,8,14H2,(H,15,17)(H,16,18) |
InChiKey: | InChIKey=NZZCKBCTSBODOF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.