* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH676547 |
| English Synonyms: | FCHGROUP FCH676547 |
| MDL Number.: | MFCD17428239 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | CCC(CC)(/C(=N/O)/N)NC(=O)c1cc[nH]n1 |
| InChi: | InChI=1S/C10H17N5O2/c1-3-10(4-2,9(11)15-17)13-8(16)7-5-6-12-14-7/h5-6,17H,3-4H2,1-2H3,(H2,11,15)(H,12,14)(H,13,16) |
| InChiKey: | InChIKey=FBYGSNMRCZZOBY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.